CAS 420-26-8
:2-Fluoropropane
Description:
2-Fluoropropane, with the CAS number 420-26-8, is an organic compound classified as a haloalkane. It features a three-carbon propane backbone with a fluorine atom attached to the second carbon. This compound is a colorless gas or liquid at room temperature, depending on the specific conditions, and has a slightly sweet odor. 2-Fluoropropane is known for its relatively low boiling point and moderate solubility in water, which is typical for fluorinated hydrocarbons. It is primarily used as a refrigerant and in various industrial applications, including as a solvent and in the synthesis of other chemical compounds. The presence of the fluorine atom imparts unique properties, such as increased stability and altered reactivity compared to its non-fluorinated counterparts. Safety considerations include its potential as a volatile organic compound (VOC) and the need for proper handling due to its flammability and possible health effects upon exposure. Overall, 2-fluoropropane is an important compound in both industrial and research settings.
Formula:C3H7F
InChI:InChI=1S/C3H7F/c1-3(2)4/h3H,1-2H3
InChI key:InChIKey=PRNZBCYBKGCOFI-UHFFFAOYSA-N
SMILES:C(C)(C)F
Synonyms:- HFC 281ea
- Isopropyl fluoride
- Propane, 2-fluoro-
- R 281ea
- 2-Fluoropropane
- 2-Fluoropropane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Isopropyl fluoride
CAS:Isopropyl fluoridePurity:98%Color and Shape:Colourless Liquified GasMolecular weight:62.09g/mol2-Fluoropropane
CAS:2-Fluoropropane is a fluorocarbon with the chemical formula CH3CH2FCL. It is a colorless, odorless gas and has a boiling point of -42°C (-44°F). 2-Fluoropropane has been used in research as a substitute for water vapor in techniques that require constant pressure. The activation energies for the reactions of hydrogen fluoride with 2-fluoropropane are different than those for 1-fluoropropane. The functional groups on 2-fluoropropane are dipole and chloride. Structural isomers of 2-fluoropropane include 3,3-difluorohexene and 3,3,3-trifluorohexene.Formula:C3H7FPurity:Min. 95%Molecular weight:62.09 g/mol

