CAS 420118-03-2
:N-[(6R,7S,8R,8aR)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide
Description:
N-[(6R,7S,8R,8aR)-6,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide, with CAS number 420118-03-2, is a chemical compound characterized by its complex bicyclic structure, which includes a pyran and dioxin moiety. This compound features multiple hydroxyl groups, contributing to its potential solubility in polar solvents and influencing its reactivity and biological activity. The presence of a phenyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry indicated by the R and S designations suggests specific spatial arrangements that can significantly affect the compound's pharmacological properties. As a derivative of a hexahydropyrano compound, it may exhibit unique properties such as antioxidant activity or enzyme inhibition, which are common in compounds with similar structural features. Overall, this compound's intricate structure and functional groups position it as a candidate for further research in drug development and therapeutic applications.
Formula:C15H19NO6
InChI:InChI=1/C15H19NO6/c1-8(17)16-11-12(18)13-10(21-14(11)19)7-20-15(22-13)9-5-3-2-4-6-9/h2-6,10-15,18-19H,7H2,1H3,(H,16,17)/t10?,11-,12+,13-,14+,15?/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactopyranose
CAS:2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactopyranose is a fluorescent dye that binds to the hydroxyl group of nucleic acids. It can be used for microscopy of cells and bacteria in culture. This dye is also used for the measurement of cavitation activity. The dye is added at a concentration of 0.1% to the cell culture media. After 24 hours, it can then be observed with a microscope under UV light. 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-galactopyranose has been shown to have lysis effects on cells such as agarose gels and mammalian cells, leading to cell death by apoptosis or necrosis. It's also used as an indicator in gel electrophoresis experiments because it can bind to DNA and RNA molecules, which makesFormula:C15H19NO6Purity:Min. 95%Color and Shape:White PowderMolecular weight:309.31 g/mol4,6-O-Benzylidene-N-acetyl-D-galactosamine
CAS:Controlled ProductApplications 4,6-O-Benzylidene-N-acetyl-D-galactosamine (cas# 420118-03-2) is a compound useful in organic synthesis.
Formula:C15H19NO6Color and Shape:NeatMolecular weight:309.31



