CAS 420137-09-3

2-[(4-methoxyphenyl)methyl]piperidine hydrochloride

Description:

2-[(4-Methoxyphenyl)methyl]piperidine hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered nitrogen-containing heterocycle. The presence of a 4-methoxyphenyl group indicates that a methoxy substituent is attached to a phenyl ring, which is further linked to the piperidine structure via a methylene bridge. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The molecular structure suggests potential interactions with biological targets, which may contribute to its pharmacological properties. It may exhibit characteristics such as moderate to high lipophilicity due to the aromatic methoxy group, influencing its absorption and distribution in biological systems. Additionally, the compound's hydrochloride form can affect its stability and reactivity. Overall, 2-[(4-methoxyphenyl)methyl]piperidine hydrochloride is of interest in medicinal chemistry, potentially serving as a precursor or active ingredient in drug development.

Formula: C₁₃H₂₀ClNO

InChI: InChI=1/C13H19NO.ClH/c1-15-13-7-5-11(6-8-13)10-12-4-2-3-9-14-12;/h5-8,12,14H,2-4,9-10H2,1H3;1H

SMILES: COc1ccc(cc1)CC1CCCCN1.Cl

Synonyms:

• 2-(4-Methoxybenzyl)piperidine hydrochloride (1:1)
• 2-(4-METHOXY-BENZYL)-PIPERIDINE HYDROCHLORIDE

2-(4-Methoxy-benzyl)-piperidine hydrochloride

CAS: 420137-09-3

2-(4-Methoxy-benzyl)-piperidine hydrochloride

Purity: ≥95%

Molecular weight: 241.76g/mol

Ref: 54-OR307743

2-(4-Methoxybenzyl)piperidine hydrochloride

CAS: 420137-09-3

Purity: 98%

Molecular weight: 241.7599945

Ref: 10-F755199