CymitQuimica logo

CAS 42019-08-9

:

ethyl 2-{4-[(4-chlorophenyl)carbonyl]phenoxy}-2-methylpropanoate

Description:
Ethyl 2-{4-[(4-chlorophenyl)carbonyl]phenoxy}-2-methylpropanoate, identified by its CAS number 42019-08-9, is an organic compound characterized by its ester functional group, which is typical of many pharmaceuticals and agrochemicals. This compound features a complex structure that includes a phenoxy group, a chlorophenyl moiety, and a branched propanoate chain. The presence of the 4-chlorophenyl group suggests potential biological activity, as halogenated aromatic compounds often exhibit significant interactions with biological systems. The ethyl ester component contributes to its solubility and volatility, which can influence its behavior in various chemical environments. Additionally, the compound's molecular structure may impart specific reactivity patterns, making it of interest in synthetic organic chemistry and potential applications in drug development or as an agrochemical. Its stability, reactivity, and interaction with other substances would depend on factors such as pH, temperature, and the presence of catalysts or other reagents. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.
Formula:C19H19ClO4
InChI:InChI=1/C19H19ClO4/c1-4-23-18(22)19(2,3)24-16-11-7-14(8-12-16)17(21)13-5-9-15(20)10-6-13/h5-12H,4H2,1-3H3
SMILES:CCOC(=O)C(C)(C)Oc1ccc(cc1)C(=O)c1ccc(cc1)Cl
Synonyms:
  • 42019-08-9
  • Fenofibric acid ethyl ester
  • Propanoic Acid, 2-[4-(4-Chlorobenzoyl)Phenoxy]-2-Methyl-, Ethyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.