CAS 42022-03-7
:(2R)-1-nitrosopyrrolidine-2-carboxylic acid
Description:
(2R)-1-nitrosopyrrolidine-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring, a nitroso group, and a carboxylic acid functional group. The presence of the nitroso group (-NO) contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nitrosation. The carboxylic acid group (-COOH) imparts acidic properties, allowing the compound to participate in acid-base reactions. This compound is typically studied in the context of organic synthesis and may have implications in medicinal chemistry due to its structural features. Its stereochemistry, indicated by the (2R) designation, suggests that it has specific spatial arrangements that can influence its biological activity and interactions with other molecules. As with many nitroso compounds, safety precautions are necessary due to potential toxicity and reactivity. Overall, (2R)-1-nitrosopyrrolidine-2-carboxylic acid is of interest in both academic research and potential applications in pharmaceuticals.
Formula:C5H8N2O3
InChI:InChI=1/C5H8N2O3/c8-5(9)4-2-1-3-7(4)6-10/h4H,1-3H2,(H,8,9)/t4-/m1/s1
SMILES:C1C[C@H](C(=O)O)N(C1)N=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
N-Nitroso-D-proline
CAS:Controlled ProductApplications A nitrosoamino acid with oncogenic activity. The LD50 of a single ip dose given to Swiss-Webster mice is 203 +/- 22 mg / kg.
References Nagasawa, H.T., et al.: J. Med. Chem., 16 (5), 583-585 (1973)Formula:C5H8N2O3Color and Shape:NeatMolecular weight:144.13



