CAS 42027-81-6
:2-(4-nitro-1H-pyrazol-1-yl)ethanol
Description:
2-(4-nitro-1H-pyrazol-1-yl)ethanol is an organic compound characterized by its pyrazole ring, which is substituted with a nitro group at the 4-position and an ethanol moiety at the 2-position. This compound typically appears as a solid or liquid depending on its purity and specific conditions. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to the presence of the pyrazole structure, which is often associated with biological activity. The nitro group contributes to its reactivity and may influence its solubility and stability in different solvents. The compound's molecular structure allows for hydrogen bonding, which can affect its interactions with other molecules. Additionally, it may exhibit properties such as moderate to high polarity, making it soluble in polar solvents. Safety data should be consulted for handling, as nitro compounds can be sensitive to heat and shock. Overall, 2-(4-nitro-1H-pyrazol-1-yl)ethanol is a compound of interest in synthetic chemistry and material science.
Formula:C5H7N3O3
InChI:InChI=1/C5H7N3O3/c9-2-1-7-4-5(3-6-7)8(10)11/h3-4,9H,1-2H2
SMILES:C(CO)n1cc(cn1)N(=O)=O
Synonyms:- 1H-Pyrazole-1-ethanol, 4-nitro-
- 2-(4-Nitro-pyrazol-1-yl)-ethanol
- 1-Hydroxyethyl-4-Nitropyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-hydroxyethyl-4-nitropyrazole
CAS:Formula:C5H7N3O3Purity:98%Color and Shape:SolidMolecular weight:157.12742-(4-Nitro-1H-pyrazol-1-yl)ethanol
CAS:2-(4-Nitro-1H-pyrazol-1-yl)ethanolPurity:98%Molecular weight:157.13g/mol2-(4-Nitro-pyrazol-1-yl)-ethanol
CAS:Formula:C5H7N3O3Purity:98%Color and Shape:SolidMolecular weight:157.1292-(4-Nitro-pyrazol-1-yl)-ethanol
CAS:2-(4-Nitro-pyrazol-1-yl)-ethanol is a cyclic anion that has been shown to be damaging to DNA. It has been studied by the kinetic methods of anion exchange chromatography and solvent extraction. 2-(4-Nitro-pyrazol-1-yl)-ethanol was found to be a weak base, with a pKb value of 10.2. The compound reacts with glutathione to form 2-(4-nitro-pyrazol-1-yl)-ethanesulfonic acid, which is in equilibrium with the corresponding alcohol. This reaction can be measured by monitoring the changes in absorbance at 260 nm and 280 nm. The nitro group on 2-(4-nitro-pyrazol-1-yl)-ethanol shifts the potentials of methylene blue and methyl green toward more positive values, making them more sensitive to this type of damage.
Formula:C5H7N3O3Purity:Min. 95%Molecular weight:157.13 g/mol



