CAS 4204-99-3
:2-(4-fluorophenyl)-1-methyl-5-nitro-1H-imidazole
Description:
2-(4-Fluorophenyl)-1-methyl-5-nitro-1H-imidazole, with the CAS number 4204-99-3, is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a 4-fluorophenyl group, indicating the presence of a fluorine atom on a phenyl ring, which can influence its electronic properties and reactivity. The nitro group at the 5-position of the imidazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. The methyl group at the 1-position enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. Overall, this compound may exhibit interesting chemical behavior and biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies and evaluations in relevant biological contexts.
Formula:C10H8FN3O2
InChI:InChI=1/C10H8FN3O2/c1-13-9(14(15)16)6-12-10(13)7-2-4-8(11)5-3-7/h2-6H,1H3
SMILES:Cn1c(cnc1c1ccc(cc1)F)N(=O)=O
Synonyms:- 1H-imidazole, 2-(4-fluorophenyl)-1-methyl-5-nitro-
- 1-Methyl-2-(p-fluorophenyl)-5-nitroimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
