CAS 42047-33-6

(3-methyl-5-thioxo-1,5-dihydro-4H-1,2,4-triazol-4-yl)acetic acid

Description:

(3-methyl-5-thioxo-1,5-dihydro-4H-1,2,4-triazol-4-yl)acetic acid is a chemical compound characterized by its unique triazole ring structure, which contributes to its biological activity. This compound features a thioxo group, enhancing its reactivity and potential interactions with biological targets. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, which can influence its solubility and reactivity in various environments. Typically, compounds like this are of interest in medicinal chemistry due to their potential pharmacological applications, including antimicrobial or antifungal properties. The methyl group attached to the triazole ring can also affect the compound's lipophilicity and overall biological activity. As with many heterocyclic compounds, the specific arrangement of atoms and functional groups plays a crucial role in determining its chemical behavior, stability, and interactions with other molecules. Overall, this compound represents a class of substances that may have significant implications in drug development and agricultural chemistry.

Formula: C₅H₇N₃O₂S

InChI: InChI=1/C5H7N3O2S/c1-3-6-7-5(11)8(3)2-4(9)10/h2H2,1H3,(H,7,11)(H,9,10)

SMILES: Cc1nnc(n1CC(=O)O)S

2-(3-Methyl-5-thioxo-1H-1,2,4-triazol-4(5H)-yl)acetic acid

CAS: 42047-33-6

2-(3-Methyl-5-thioxo-1H-1,2,4-triazol-4(5H)-yl)acetic acid

Purity: ≥95%

Molecular weight: 173.19g/mol

Ref: 54-OR309408