CAS 42059-48-3

4-acetyl-3-hydroxyphenyl acetate

Description:

4-Acetyl-3-hydroxyphenyl acetate, with the CAS number 42059-48-3, is an organic compound characterized by its aromatic structure, which includes a phenolic hydroxyl group and an acetyl group. This compound typically appears as a white to off-white solid or crystalline substance. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic aromatic ring. The presence of both the acetyl and hydroxyl functional groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and acylation. Additionally, this compound may exhibit biological activity, which can be explored in pharmaceutical and agrochemical applications. Its melting point, boiling point, and specific reactivity profiles would depend on the conditions under which it is studied. Overall, 4-acetyl-3-hydroxyphenyl acetate is of interest in both synthetic organic chemistry and potential applications in medicinal chemistry.

Formula: C₁₀H₁₀O₄

InChI: InChI=1/C10H10O4/c1-6(11)9-4-3-8(5-10(9)13)14-7(2)12/h3-5,13H,1-2H3

SMILES: CC(=O)c1ccc(cc1O)OC(=O)C

4-Acetyl-3-hydroxyphenyl acetate

CAS: 42059-48-3

Formula: C₁₀H₁₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 194.1840

Ref: IN-DA00BXY1

4-acetyl-3-hydroxyphenyl acetate

CAS: 42059-48-3

4-acetyl-3-hydroxyphenyl acetate

Purity: ≥95%

Molecular weight: 194.18399g/mol

Ref: 54-OR22001

4-Acetyl-3-hydroxyphenyl Acetate

CAS: 42059-48-3

Formula: C₁₀H₁₀O₄

Purity: >98.0%(GC)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 194.19

Ref: 3B-A2960