CAS 42059-80-3
:3-Formyl-6-nitrochromone
Description:
3-Formyl-6-nitrochromone is an organic compound belonging to the chromone family, characterized by a chromone backbone with specific functional groups. It features a formyl group (-CHO) at the 3-position and a nitro group (-NO2) at the 6-position of the chromone ring. This compound typically exhibits a yellow to orange color, which is common for nitro-substituted aromatic compounds. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic additions and cycloadditions. The presence of both the formyl and nitro groups can influence its electronic properties, making it a subject of interest in studies related to fluorescence and photochemical behavior. Additionally, 3-Formyl-6-nitrochromone may exhibit biological activity, which warrants further investigation into its potential therapeutic uses. As with many organic compounds, handling should be done with care, considering safety protocols due to its chemical reactivity and potential toxicity.
Formula:C10H5NO5
InChI:InChI=1/C10H5NO5/c12-4-6-5-16-9-2-1-7(11(14)15)3-8(9)10(6)13/h1-5H
InChI key:InChIKey=JBDRQGWTNRIJRV-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(N(=O)=O)C2)OC=C1C=O
Synonyms:- 3-Formyl-6-Nitro Chromone
- 4H-1-Benzopyran-3-carboxaldehyde, 6-nitro-4-oxo-
- 6-Nitro-4-oxo-4H-1-benzopyran-3-carboxaldehyde
- 6-Nitrochromone-3-carboxaldehyde
- 6-nitro-4-oxo-4H-chromene-3-carbaldehyde
- 3-Formyl-6-nitrochromone
- 6-nitro-4-oxochromene-3-carbaldehyde
- 6-NITROCHROMONE-3-CARBALDEHYDE
- 6-Nitro chromone-3-carboxaldehyde
- 6-nitro-4-oxo-1-benzopyran-3-carboxaldehyde
- JRH-00114, 6-Nitro-4-oxo-4H-chromene-3-carbaldehyde, 97%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-FORMYL-6-NITROCHROMONE
CAS:Formula:C10H5NO5Purity:94%Color and Shape:SolidMolecular weight:219.15043-Formyl-6-nitrochromone
CAS:3-Formyl-6-nitrochromone is a type of sensor molecule that can be used in the detection of metal ions. It is an aromatic compound that has been shown to reversibly react with copper and other metal ions, which leads to a change in its fluorescence. 3-Formyl-6-nitrochromone reacts with the copper ion by donating an electron and forming a copper complex. This reaction is reversible, so it can be used as a sensor for copper ions. The sensor has been shown to have good spectral properties and chemosensors have been developed using this molecule.Formula:C10H5NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:219.15 g/mol3-Formyl-6-nitrochromone
CAS:Formula:C10H5NO5Purity:94%Color and Shape:Solid, Yellow powderMolecular weight:219.152




