CymitQuimica logo

CAS 42060-28-6

:

N-[(4-Methylphenyl)methyl]methanesulfonamide

Description:
N-[(4-Methylphenyl)methyl]methanesulfonamide, with the CAS number 42060-28-6, is an organic compound characterized by its sulfonamide functional group, which is known for its biological activity and potential pharmaceutical applications. This compound features a methanesulfonamide moiety attached to a 4-methylphenyl group via a methyl linkage, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group, which can engage in hydrogen bonding. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the methyl group on the phenyl ring may influence its lipophilicity and overall reactivity. Safety and handling precautions should be observed, as with many sulfonamides, due to potential toxicity and allergenic properties. Overall, N-[(4-Methylphenyl)methyl]methanesulfonamide represents a class of compounds that can be explored for various applications in drug development and chemical synthesis.
Formula:C9H13NO2S
InChI:InChI=1S/C9H13NO2S/c1-8-3-5-9(6-4-8)7-10-13(2,11)12/h3-6,10H,7H2,1-2H3
InChI key:InChIKey=SHVDFMIJUDOASZ-UHFFFAOYSA-N
SMILES:C(NS(C)(=O)=O)C1=CC=C(C)C=C1
Synonyms:
  • N-[(4-Methylphenyl)methyl]methanesulfonamide
  • Methanesulfonamide, N-[(4-methylphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.