CymitQuimica logo

CAS 42060-30-0

:

N-[(4-Chlorophenyl)methyl]methanesulfonamide

Description:
N-[(4-Chlorophenyl)methyl]methanesulfonamide, with the CAS number 42060-30-0, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methanesulfonamide moiety attached to a 4-chlorobenzyl group, indicating the presence of a chlorine atom on the phenyl ring, which can influence its biological activity and solubility. The sulfonamide group contributes to its potential as a pharmacological agent, often utilized in medicinal chemistry for its ability to inhibit bacterial growth. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Safety and handling precautions are essential, as with many sulfonamides, due to potential allergic reactions or toxicity. Overall, N-[(4-Chlorophenyl)methyl]methanesulfonamide represents a class of compounds with significant relevance in medicinal chemistry and pharmacology.
Formula:C8H10ClNO2S
InChI:InChI=1S/C8H10ClNO2S/c1-13(11,12)10-6-7-2-4-8(9)5-3-7/h2-5,10H,6H2,1H3
InChI key:InChIKey=CRYRIYLKDDYXOB-UHFFFAOYSA-N
SMILES:C(NS(C)(=O)=O)C1=CC=C(Cl)C=C1
Synonyms:
  • Methanesulfonamide, N-p-chlorobenzyl-
  • N-[(4-Chlorophenyl)methyl]methanesulfonamide
  • N-(4-Chlorobenzyl)methanesulfonamide
  • Methanesulfonamide, N-[(4-chlorophenyl)methyl]-
Found 2 products.