CAS 42072-27-5
:Phosphoramidothioic acid, N-acetyl-, O,O-dimethyl ester
Description:
Phosphoramidothioic acid, N-acetyl-, O,O-dimethyl ester, with the CAS number 42072-27-5, is a chemical compound that belongs to the class of organophosphorus compounds. It typically features a phosphorus atom bonded to sulfur and nitrogen, which contributes to its unique reactivity and properties. This compound is characterized by the presence of an acetyl group and two methoxy groups attached to the phosphorus atom, which can influence its solubility and stability. It is often used in various chemical applications, including as a reagent in organic synthesis and potentially in agricultural chemistry. The presence of the phosphoramidothioic structure suggests that it may exhibit biological activity, possibly interacting with enzymes or other biological molecules. Safety data indicates that, like many organophosphorus compounds, it should be handled with care due to potential toxicity. Overall, its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the precise molecular structure and environmental conditions.
Formula:C4H10NO3PS
InChI:InChI=1/C4H10NO3PS/c1-4(6)5-9(10,7-2)8-3/h1-3H3,(H,5,6,10)
InChI key:InChIKey=QXKNLUMRVZYMRN-UHFFFAOYSA-N
SMILES:P(NC(C)=O)(OC)(OC)=S
Synonyms:- O,O-Dimethyl-N-acetylphosphoramidothioate
- O,O-dimethyl acetylphosphoramidothioate
- Phosphoramidothioic acid, N-acetyl-, O,O-dimethyl ester
- Phosphoramidothioic acid, acetyl-, O,O-dimethyl ester
- O,O-Dimethyl acetylthiophosphoramidate
- Acetylamidothiophosphoric acid O,O-dimethyl ester
- N-dimethoxyphosphinothioylacetamide
- O,O-DIMETHYL-N-ACETYL THIOPHOSPHAMIDE
- DIMETHYLACETYLPHOSPHORAMIDOTHIOATE
- O,O Dimethyl acetyl phosphoroamidothioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
O,O-Dimethyl acetylphosphoramidothioate
CAS:Controlled ProductFormula:C4H10NO3PSColor and Shape:NeatMolecular weight:183.166
