CAS 42075-29-6
:4-(4-Aminophenyl)-3-methyl-4-oxobutyric acid
Description:
4-(4-Aminophenyl)-3-methyl-4-oxobutyric acid, also known by its CAS number 42075-29-6, is an organic compound characterized by its structure, which includes an aminophenyl group and a ketone functional group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of both hydrophobic and hydrophilic regions in its molecular structure. It features a carboxylic acid group, which contributes to its acidic properties and potential reactivity in various chemical reactions. The presence of the amino group allows for potential interactions in biological systems, making it of interest in pharmaceutical research. Its molecular structure suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound's unique arrangement of functional groups may impart specific biological activities, making it a candidate for further investigation in medicinal chemistry. Overall, 4-(4-Aminophenyl)-3-methyl-4-oxobutyric acid exhibits characteristics typical of compounds with both aromatic and aliphatic features, contributing to its versatility in chemical applications.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-7(6-10(13)14)11(15)8-2-4-9(12)5-3-8/h2-5,7H,6,12H2,1H3,(H,13,14)
SMILES:CC(CC(=O)O)C(=O)c1ccc(cc1)N
Synonyms:- 4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid
- Benzenebutanoic Acid, 4-Amino-Beta-Methyl-Gamma-Oxo-
- Levosimendan Intermediate-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid
CAS:Formula:C11H13NO3Purity:97%Color and Shape:SolidMolecular weight:207.22584-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid
CAS:4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acidPurity:97%Molecular weight:207.23g/mol4-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid
CAS:4-(4-Aminophenyl)-3-methyl-4-oxobutanoicacid is a chemical substance that has been shown to be effective in treating insects. It is also used as an insecticide and herbicide. 4-(4-Aminophenyl)-3-methyl-4-oxobutanoicacid has been shown to have a high toxicity against insects, with a LD50 value of 5.6 mg/kg. This compound has been tested for its effects against the weevil species Rhinotia haemoptera, which is a pest that damages crops in Australia. 4-(4-Aminophenyl)-3-methyl-4-oxobutanoicacid was found to be highly toxic to this species of insect with an LC50 value of 0.1%.Formula:C11H13NO3Purity:Min. 95%Color and Shape:SolidMolecular weight:207.23 g/mol3-(p-Aminobenzoyl)butyric Acid
CAS:Controlled ProductApplications 3-(p-Aminobenzoyl)butyric Acid is an intermediate in the synthesis of novel cardiotonic agents with vasodilator properties.
References Mochizuki, N., et al.: J. Cardiovasc. Pharmacol., 21, 983 (1993);Formula:C11H13NO3Color and Shape:NeatMolecular weight:207.234-(4-Aminophenyl)-3-methyl-4-oxobutanoic acid
CAS:Formula:C11H13NO3Purity:97%Color and Shape:SolidMolecular weight:207.229




