CAS 4208-67-7
:dUDP
Description:
dUDP, or deoxyuridine diphosphate, is a nucleotide that plays a crucial role in the synthesis of DNA. It is a pyrimidine nucleotide, specifically a derivative of uridine, where the hydroxyl group at the 2' position of the ribose sugar is replaced by a hydrogen atom, resulting in a deoxyribose sugar. The chemical structure of dUDP includes a uracil base, a ribose sugar, and two phosphate groups. This compound is involved in various biochemical processes, particularly in the synthesis of deoxythymidine triphosphate (dTTP), which is essential for DNA replication and repair. dUDP is also a substrate for the enzyme deoxyuridine triphosphate nucleotidohydrolase, which catalyzes the conversion of dUDP to dUMP, a precursor for dTTP synthesis. In terms of solubility, dUDP is typically soluble in water, making it accessible for various biochemical assays and applications. Its role in nucleotide metabolism underscores its importance in cellular processes and genetic material integrity.
Formula:C9H14N2O11P2
InChI:InChI=1/C9H14N2O11P2/c12-5-3-8(11-2-1-7(13)10-9(11)14)21-6(5)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,12H,3-4H2,(H,18,19)(H,10,13,14)(H2,15,16,17)/t5-,6+,8+/m0/s1
InChI key:InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-N
SMILES:O=C1N(C=CC(=O)N1)[C@@H]2O[C@H](COP(OP(=O)(O)O)(=O)O)[C@@H](O)C2
Synonyms:- dUDP
- Uridine, 2′-deoxy-, 5′-pyrophosphate
- 2′-Deoxyuridine 5′-(trihydrogen diphosphate)
- Uridine 5′-(trihydrogen diphosphate), 2′-deoxy-
- Uridine, 2′-deoxy-, 5′-(trihydrogen pyrophosphate)
- [[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]oxyphosphonic acid
- 2'-Deoxyuridine-5'-diphosphate - Aqueous solution
- 2'-Deoxyuridine-5'-diphosphate triethylammonium salt - 10 mM aqueous solution
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2'-Deoxyuridine-5'-diphosphate triethylammonium, 10 mM aqueous solution
CAS:a deoxynucleotide diphosphate
Formula:C9H14N2O11P2•C6H15NMolecular weight:489.35 g/moldUDP (Deoxyuridine Diphosphate)-13C,15N2 Triammonium Salt
CAS:Controlled ProductFormula:C8CH14N2O11P2•3(NH4)Color and Shape:NeatMolecular weight:406.04166


