CymitQuimica logo

CAS 420844-68-4

:

1-(pyrazin-2-yl)piperidin-4-ol

Description:
1-(Pyrazin-2-yl)piperidin-4-ol is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a pyrazine moiety and a hydroxyl group. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including potential solubility in polar solvents due to the presence of the hydroxyl group. The pyrazine ring contributes to its aromatic character, which can influence its reactivity and interaction with biological targets. The presence of the piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often found in various drug candidates. Additionally, the compound may exhibit specific biological activities, making it of interest in research related to neuropharmacology or other therapeutic areas. Its molecular structure allows for various functionalization possibilities, which can be explored for enhancing its efficacy or selectivity in biological systems. Overall, 1-(pyrazin-2-yl)piperidin-4-ol represents a versatile scaffold in chemical and pharmaceutical research.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c13-8-1-5-12(6-2-8)9-7-10-3-4-11-9/h3-4,7-8,13H,1-2,5-6H2
InChI key:AVQZNWLWBIBYPF-UHFFFAOYSA-N
SMILES:C1CN(CCC1O)C2=NC=CN=C2
Found 2 products.