CAS 42089-03-2

N-[5-(1-chloro-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide

Description:

N-[5-(1-chloro-2-methylpropan-2-yl)-1,3,4-thiadiazol-2-yl]cyclopropanecarboxamide is a chemical compound characterized by its unique structure, which includes a cyclopropanecarboxamide moiety and a thiadiazole ring. The presence of the thiadiazole ring contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The compound features a chloro substituent and a branched alkyl group, which may influence its solubility and reactivity. Typically, compounds like this may exhibit properties such as antimicrobial, antifungal, or herbicidal activities, depending on their specific interactions with biological targets. The cyclopropane ring adds strain and can enhance reactivity, making it an interesting candidate for further chemical modifications. Additionally, the presence of the amide functional group suggests potential for hydrogen bonding, which can affect its physical properties and interactions in biological systems. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and agricultural applications.

Formula: C₁₀H₁₄ClN₃OS

InChI: InChI=1/C10H14ClN3OS/c1-10(2,5-11)8-13-14-9(16-8)12-7(15)6-3-4-6/h6H,3-5H2,1-2H3,(H,12,14,15)

SMILES: CC(C)(CCl)c1nnc(N=C(C2CC2)O)s1

Synonyms:

• Cyprazole

Cyprazole

CAS: 42089-03-2

Cyprazole is an analog of a protein found in Chinese urine that has been shown to have potent anticancer activity. It inhibits the growth of cancer cells by targeting specific kinases involved in tumor cell proliferation and survival. Cyprazole has been shown to induce apoptosis, or programmed cell death, in human cancer cells. This compound is also known for its ability to inhibit the activity of luciferase, an enzyme commonly used in bioluminescence assays. Cyprazole is formulated with mannitol for improved solubility and delivery. As a promising anticancer agent, cyprazole holds great potential for the development of novel cancer therapies and inhibitors.

Formula: C₁₀H₁₄ClN₃OS

Purity: Min. 95%

Molecular weight: 259.76 g/mol

Ref: 3D-SBA08903