CAS 42098-25-9

5-Chloro-1-methyl-4-nitro-1H-pyrazole

Description:

5-Chloro-1-methyl-4-nitro-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chlorine atom at the 5-position, a methyl group at the 1-position, and a nitro group at the 4-position of the pyrazole ring. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The presence of the nitro group contributes to its potential reactivity and may influence its chemical behavior, including its ability to participate in electrophilic substitution reactions. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Chloro-1-methyl-4-nitro-1H-pyrazole is a notable compound in synthetic organic chemistry with applications that warrant further exploration.

Formula: C₄H₄ClN₃O₂

InChI: InChI=1S/C4H4ClN3O2/c1-7-4(5)3(2-6-7)8(9)10/h2H,1H3

SMILES: Cn1c(c(cn1)N(=O)=O)Cl

5-Chloro-1-methyl-4-nitro-1H-pyrazole

CAS: 42098-25-9

Formula: C₄H₄ClN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.5465

Ref: IN-DA00C6L8

5-Chloro-1-methyl-4-nitro-1H-pyrazole

CAS: 42098-25-9

5-Chloro-1-methyl-4-nitro-1H-pyrazole

Purity: 97%

Color and Shape: White Powder

Molecular weight: 161.55g/mol

Ref: 54-OR302127

5-Chloro-1-methyl-4-nitro-1H-pyrazole

CAS: 42098-25-9

Formula: C₄H₄ClN₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 161.55

Ref: 10-F215347

5-Chloro-1-methyl-4-nitro-1H-pyrazole

CAS: 42098-25-9

5-Chloro-1-methyl-4-nitro-1H-pyrazole is a nucleophilic substitutive agent that is used in the synthesis of 7-deazapurines. 5-Chloro-1-methyl-4-nitro-1H-pyrazole is synthesized through a cross coupling reaction between an aldehyde and an azide. It has been shown to inhibit hepatitis C virus replication by interfering with the viral life cycle. It also inhibits the proliferation of cancer cells, which may be due to its ability to inhibit the production of certain proteins such as p21 and cyclin A.

Formula: C₄H₄ClN₃O₂

Purity: Min. 95%

Molecular weight: 161.55 g/mol

Ref: 3D-SBA09825