CAS 421-41-0
:1,1,2-Trichloro-1-fluoropropane
Description:
1,1,2-Trichloro-1-fluoropropane, with the CAS number 421-41-0, is a halogenated organic compound that belongs to the class of chlorofluorocarbons (CFCs). It is characterized by its molecular formula, which includes three chlorine atoms and one fluorine atom attached to a propane backbone. This compound is typically a colorless liquid at room temperature and has a relatively low boiling point. It is known for its use as a solvent and in various industrial applications, particularly in the production of other chemicals. The presence of multiple halogen atoms contributes to its chemical stability and resistance to degradation, but also raises concerns regarding its environmental impact, particularly in relation to ozone depletion. 1,1,2-Trichloro-1-fluoropropane is classified as a volatile organic compound (VOC) and may pose health risks upon exposure, necessitating careful handling and regulation. Its physical and chemical properties make it useful in specific applications, but also highlight the importance of monitoring its use due to potential environmental and health implications.
Formula:C3H4Cl3F
InChI:InChI=1/C3H4Cl3F/c1-2(4)3(5,6)7/h2H,1H3
InChI key:InChIKey=WLJAYGJMTFQRCH-UHFFFAOYSA-N
SMILES:C(C(C)Cl)(Cl)(Cl)F
Synonyms:- Propane, 1,1,2-trichloro-1-fluoro-
- 1,1,2-Trichloro-1-fluoropropane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,1,2-Trichloro-1-fluoropropane
CAS:Controlled Product1,1,2-Trichloro-1-fluoropropane is a solvent used in the production of fluorinated organic compounds. It is used as an intermediate for the manufacture of refrigerants and aerosol propellants. 1,1,2-Trichloro-1-fluoropropane has been shown to have a significant impact on the environment due to its high volatility and solubility. The emission of this chemical into the atmosphere can deplete ozone levels and cause damage to vegetation. This chemical also has a high vapor pressure and can be fatal if inhaled or absorbed through the skin. In addition, 1,1,2-Trichloro-1-fluoropropane is toxic to aquatic life because it is soluble in water and accumulates in fatty tissues of living organisms.
Formula:C3H4Cl3FPurity:Min. 95%Molecular weight:165.42 g/mol
