CAS 421-94-3: 1,1,1,2,3-Pentachloro-2-fluoropropane
Description:1,1,1,2,3-Pentachloro-2-fluoropropane, with the CAS number 421-94-3, is a halogenated organic compound characterized by its complex structure featuring multiple chlorine and fluorine atoms. This compound is a colorless liquid at room temperature and is known for its high density and low volatility. It exhibits significant chemical stability due to the presence of strong carbon-chlorine and carbon-fluorine bonds, making it resistant to degradation. Its applications primarily lie in the field of industrial solvents and as an intermediate in chemical synthesis. The presence of multiple chlorine atoms contributes to its potential as a refrigerant and its use in various chemical processes. However, due to environmental concerns associated with halogenated compounds, particularly regarding their potential to contribute to ozone depletion and other ecological impacts, its use is subject to regulatory scrutiny. Safety measures are essential when handling this substance, as it may pose health risks through inhalation or skin contact.
Formula:C3H2Cl5F
InChI:InChI=1S/C3H2Cl5F/c4-1-2(5,9)3(6,7)8/h1H2
InChI key:InChIKey=SHUGOEUQWSDPPJ-UHFFFAOYSA-N
SMILES:FC(Cl)(CCl)C(Cl)(Cl)Cl
- Synonyms:
- 2-Fluoro-1,1,1,2,3-pentachloropropane
- HCFC 231bb
- Propane, 1,1,1,2,3-pentachloro-2-fluoro-
- 1,1,1,2,3-Pentachloro-2-fluoropropane
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,1,1,2,3-Pentachloro-2-fluoropropane REF: 3D-FP83350CAS: 421-94-3 | Min. 95% | To inquire | Wed 23 Apr 25 |

1,1,1,2,3-Pentachloro-2-fluoropropane
Controlled ProductRef: 3D-FP83350
Undefined size | To inquire |