CAS 42105-98-6
:3-(methylamino)-3-oxopropanoic acid
Description:
3-(Methylamino)-3-oxopropanoic acid, also known by its CAS number 42105-98-6, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group. This compound features a propanoic acid backbone with a methylamino substituent at the alpha position, contributing to its unique properties. It typically appears as a white to off-white solid or crystalline substance. The presence of the ketone group (oxopropanoic) indicates that it can participate in various chemical reactions, including those typical of both amino acids and keto acids. This compound is soluble in water due to its polar functional groups, making it relevant in biochemical applications, particularly in the study of metabolic pathways and amino acid synthesis. Its structural features suggest potential roles in biological systems, possibly as an intermediate in metabolic processes or as a building block for more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential reactivity.
Formula:C4H7NO3
InChI:InChI=1/C4H7NO3/c1-5-3(6)2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8)
SMILES:CN=C(CC(=O)O)O
Synonyms:- Propanoic Acid, 3-(Methylamino)-3-Oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(Methylamino)-3-oxopropanoic acid
CAS:3-(Methylamino)-3-oxopropanoic acidPurity:95%Molecular weight:117.104g/mol3-(methylamino)-3-oxopropanoic acid
CAS:Controlled ProductApplications 3-(methylamino)-3-oxopropanoic acid (cas# 42105-98-6) is a useful research chemical.
Formula:C4H7NO3Color and Shape:NeatMolecular weight:117.13-(Methylamino)-3-oxopropanoic acid
CAS:3-(Methylamino)-3-oxopropanoic acid is a metabolite of nitroprusside. It is a potent inhibitor of the uptake of nitrates by cells, which causes cell lysis. 3-(Methylamino)-3-oxopropanoic acid has been shown to inhibit the uptake and transport chain of amino acids in the human metabolism. This results in an accumulation of metabolites that are toxic to cells and can lead to necrosis. 3-(Methylamino)-3-oxopropanoic acid is also a biocide with anti-inflammatory properties. It inhibits monoclonal antibody production by blocking protein synthesis and has been shown to be effective against tumor growth in animal models.
Formula:C4H7NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:117.1 g/mol3-(methylamino)-3-oxopropanoic acid
CAS:Formula:C4H7NO3Purity:95%Color and Shape:SolidMolecular weight:117.104





