CAS 42108-38-3

N,N'-dimethyl-N'-phenylacetohydrazide

Description:

N,N'-Dimethyl-N'-phenylacetohydrazide is an organic compound characterized by its hydrazide functional group, which is derived from the reaction of phenylacetyl chloride with dimethylhydrazine. This compound typically appears as a crystalline solid and is known for its potential applications in organic synthesis and as a reagent in various chemical reactions. It features a hydrazide linkage, which imparts specific reactivity, particularly in condensation reactions and as a potential precursor for the synthesis of more complex molecules. The presence of both dimethyl and phenyl groups contributes to its unique chemical properties, influencing solubility and reactivity. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as with any chemical substance, to understand its handling, storage, and potential hazards. Overall, N,N'-dimethyl-N'-phenylacetohydrazide serves as a valuable compound in the field of organic chemistry, with diverse applications in research and industry.

Formula: C₁₀H₁₄N₂O

InChI: InChI=1/C10H14N2O/c1-9(13)11(2)12(3)10-7-5-4-6-8-10/h4-8H,1-3H3

SMILES: CC(=O)N(C)N(C)c1ccccc1

N,N'-Dimethyl-N'-phenylacetohydrazide

CAS: 42108-38-3

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-SBA10838