CymitQuimica logo

CAS 42116-77-8

:

(+)-2,3,5,6-Tetrahydro-3-phenyl-1H-imidazo[1,2-a]imidazole

Description:
(+)-2,3,5,6-Tetrahydro-3-phenyl-1H-imidazo[1,2-a]imidazole is a bicyclic organic compound characterized by its imidazole ring structure fused with a saturated ring system. This compound features a phenyl group, which contributes to its aromatic properties and potential interactions in biological systems. It is known for its chiral nature, with the (+) designation indicating the specific stereochemistry of the molecule. The presence of nitrogen atoms in the imidazole rings imparts basicity and potential reactivity, making it of interest in medicinal chemistry and drug design. The compound may exhibit various biological activities, including potential effects on the central nervous system or other physiological processes. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound represents a unique structure that may serve as a scaffold for the development of novel therapeutic agents.
Formula:C11H13N3
InChI:InChI=1S/C11H13N3/c1-2-4-9(5-3-1)10-8-13-11-12-6-7-14(10)11/h1-5,10H,6-8H2,(H,12,13)
InChI key:InChIKey=VVLJQSJNPKNTAT-UHFFFAOYSA-N
SMILES:C1(N2C(NC1)=NCC2)C3=CC=CC=C3
Synonyms:
  • (+)-2,3,5,6-Tetrahydro-3-phenyl-1H-imidazo[1,2-a]imidazole
  • 1H-Imidazo[1,2-a]imidazole, 2,3,5,6-tetrahydro-3-phenyl-, (+)-
  • Deximafen
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.