CAS 4212-93-5
:Terbuchlor
Description:
Terbuchlor, with the CAS number 4212-93-5, is a chemical compound that belongs to the class of chlorinated hydrocarbons. It is characterized by its structure, which typically includes multiple chlorine atoms attached to a carbon backbone. This compound is known for its applications in various industrial processes, particularly as a solvent or in the synthesis of other chemicals. Terbuchlor exhibits properties such as high stability and resistance to degradation, making it useful in environments where chemical durability is essential. However, like many chlorinated compounds, it may pose environmental and health risks, including potential toxicity and bioaccumulation. Safety measures are crucial when handling Terbuchlor, as exposure can lead to adverse health effects. Its physical properties, such as boiling point and solubility, can vary based on its specific formulation and purity. Overall, Terbuchlor is a significant compound in the realm of organic chemistry, with applications that necessitate careful consideration of its environmental and health impacts.
Formula:C18H28ClNO2
InChI:InChI=1/C18H28ClNO2/c1-6-7-11-22-13-20(16(21)12-19)17-14(2)9-8-10-15(17)18(3,4)5/h8-10H,6-7,11-13H2,1-5H3
InChI key:InChIKey=KGMBZDZHRAFLBY-UHFFFAOYSA-N
SMILES:N(COCCCC)(C(CCl)=O)C1=C(C(C)(C)C)C=CC=C1C
Synonyms:- 4212-93-5
- Acetamide, N-(butoxymethyl)-2-chloro-N-[2-(1,1-dimethylethyl)-6-methylphenyl]-
- Mon 0358
- N-(Butoxymethyl)-2-chloro-N-[2-(1,1-dimethylethyl)-6-methylphenyl]acetamide
- N-(Butoxymethyl)-2-chloro-N-[2-methyl-6-(2-methyl-2-propanyl)phenyl]acetamide
- N-(Butoxymethyl)-6'-tert-butyl-2-chloro-o-acetoluidide
- N-(Butoxymethyl)-6′-tert-butyl-2-chloro-o-acetotoluidide
- N-(Butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloracetamid
- N-Butoxymethyl-6'-tert-butyl-2-chloroacet-o-toluidide
- Terbuchlor
- o-Acetotoluidide, N-(butoxymethyl)-6'-tert-butyl-2-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Terbuchlor
CAS:Terbuchlor is a potent inhibitor of kinases, which are proteins that play a crucial role in cell signaling pathways. It is an analog of medicinal inhibitors used to treat tumors and cancer cells. Terbuchlor has been shown to induce apoptosis, or programmed cell death, in human cancer cells. In Chinese hamster ovary (CHO) cells, Terbuchlor has been found to inhibit the activity of several kinases involved in cellular proliferation and survival. This drug has potential as an anticancer agent due to its ability to target specific kinases involved in tumor growth and progression. Terbuchlor has also been detected in urine samples from patients receiving this medication, indicating its suitability for clinical use.Formula:C18H28ClNO2Purity:Min. 95%Molecular weight:325.9 g/mol
