CymitQuimica logo

CAS 4213-32-5

:

(1R)-2-{4-[bis(2-chloroethyl)amino]phenyl}-1-carboxyethanaminium chloride

Description:
The chemical substance known as (1R)-2-{4-[bis(2-chloroethyl)amino]phenyl}-1-carboxyethanaminium chloride, with the CAS number 4213-32-5, is a quaternary ammonium compound characterized by its complex structure, which includes a carboxyethyl group and a bis(2-chloroethyl)amino moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in water and the ability to act as a cationic surfactant. Its structure suggests potential applications in medicinal chemistry, particularly in the development of anticancer agents, due to the presence of the chloroethyl groups, which are known to participate in alkylation reactions with DNA. The presence of the carboxylic acid functional group may also impart acidic properties, influencing its reactivity and interaction with biological systems. Overall, this compound's unique characteristics make it a subject of interest in both pharmaceutical research and chemical synthesis.
Formula:C13H19Cl3N2O2
InChI:InChI=1/C13H18Cl2N2O2.ClH/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19;/h1-4,12H,5-9,16H2,(H,18,19);1H/t12-;/m1./s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.