CAS 42135-38-6

9-oxo-9H-fluorene-4-carboxamide

Description:

9-Oxo-9H-fluorene-4-carboxamide, with the CAS number 42135-38-6, is a chemical compound characterized by its unique structure, which includes a fluorene backbone with a ketone and an amide functional group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and materials science. The presence of the carbonyl (C=O) and amide (C=O-NH) groups contributes to its reactivity, making it a candidate for various chemical reactions, including condensation and substitution reactions. Additionally, the fluorene moiety imparts certain electronic properties, which can influence its behavior in photochemical processes. The compound may also exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its stability and reactivity can vary depending on the conditions, such as temperature and the presence of other reagents. Overall, 9-oxo-9H-fluorene-4-carboxamide is of interest in both academic research and industrial applications due to its distinctive chemical properties.

Formula: C₁₄H₉NO₂

InChI: InChI=1/C14H9NO2/c15-14(17)11-7-3-6-10-12(11)8-4-1-2-5-9(8)13(10)16/h1-7H,(H2,15,17)

SMILES: c1ccc2c(c1)c1c(cccc1C(=N)O)C2=O

9-Oxo-9H-fluorene-4-carboxamide

CAS: 42135-38-6

9-Oxo-9H-fluorene-4-carboxamide

Purity: ≥95%

Molecular weight: 223.23g/mol

Ref: 54-OR0483