CAS 42135-78-4
:4-(1-Naphthyl)-3-thiosemicarbazide
Description:
4-(1-Naphthyl)-3-thiosemicarbazide is an organic compound characterized by its thiosemicarbazide functional group, which includes a thiocarbonyl moiety. This compound features a naphthyl group, contributing to its aromatic properties and potential biological activity. It typically appears as a solid and may exhibit moderate solubility in organic solvents. The presence of the thiosemicarbazide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to form coordination complexes with metal ions and its potential as a bioactive agent. The compound may also display various chemical reactivity patterns, including the ability to undergo condensation reactions and form derivatives. Its structure allows for interactions with biological targets, making it of interest in research related to anti-cancer and antimicrobial activities. As with many thiosemicarbazides, safety precautions should be taken when handling this compound, as it may pose health risks. Overall, 4-(1-Naphthyl)-3-thiosemicarbazide is a compound of interest in both synthetic and medicinal chemistry.
Formula:C11H11N3S
InChI:InChI=1/C11H11N3S/c12-14-11(15)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,12H2,(H2,13,14,15)
SMILES:c1ccc2c(c1)cccc2N=C(NN)S
Synonyms:- N-naphthalen-1-ylhydrazinecarbothioamide
- 1-amino-3-(1-naphthalenyl)thiourea
- n-(Naphthalen-1-yl)hydrazinecarbothioamide
- 4-(1-phthyl)-3-thiosemicarbazide
- Hydrazinecarbothioamide, N-1-naphthalenyl-
- 4-(1-NAPHTHYL)-3-THIOSEMICARBAZIDE
- 4-(1-Naphtyl)thiosemicarbazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-(1-Naphthyl)-3-thiosemicarbazide
CAS:Formula:C11H11N3SColor and Shape:SolidMolecular weight:217.29014-(1-Naphthyl)-3-thiosemicarbazide
CAS:4-(1-Naphthyl)-3-thiosemicarbazide
Molecular weight:217.29014g/mol



