CAS 42139-37-7

1-isopropyl-4-(2-nitrovinyl)benzene

Description:

1-Isopropyl-4-(2-nitrovinyl)benzene, with the CAS number 42139-37-7, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an isopropyl group and a nitrovinyl group. The presence of the isopropyl group contributes to its hydrophobic nature, while the nitrovinyl moiety introduces both electron-withdrawing characteristics and potential reactivity due to the presence of the nitro group. This compound may exhibit interesting electronic properties and could participate in various chemical reactions, such as electrophilic substitutions or polymerization processes. Its nitrovinyl group can also be involved in conjugation, affecting the compound's optical properties. The compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the nitro group, which can be associated with toxicity and environmental concerns.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1/C11H13NO2/c1-9(2)11-5-3-10(4-6-11)7-8-12(13)14/h3-9H,1-2H3/b8-7+

Synonyms:

• 4-Isopropyl-w-nitrostyrene
• 1-(1-Methylethyl)-4-(2-Nitroethenyl)Benzene
• 1-(1-methylethyl)-4-[(E)-2-nitroethenyl]benzene

4-ISOPROPYL-ω-NITROSTYRENE

CAS: 42139-37-7

Formula: C₁₁H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.2264

Ref: IN-DA003LLL

1-isopropyl-4-(2-nitrovinyl)benzene

CAS: 42139-37-7

1-isopropyl-4-(2-nitrovinyl)benzene

Purity: 95%

Molecular weight: 191.23g/mol

Ref: 54-OR28554

4-isoPropylphenylnitroethene

CAS: 42139-37-7

4-IsoPropylphenylnitroethene is a fine chemical that is used as a versatile building block in the synthesis of complex compounds. 4-IsoPropylphenylnitroethene is an intermediate that can be used to synthesize other chemicals, such as research chemicals and reaction components. It can also be used as a reagent or speciality chemical. This compound has high quality, making it useful for research purposes.

Formula: C₁₁H₁₃NO₂

Purity: Min. 95%

Molecular weight: 191.23 g/mol

Ref: 3D-FI67252