CAS 42155-93-1
:glu-gly-phe
Description:
The chemical substance known as "glu-gly-phe," with the CAS number 42155-93-1, is a tripeptide composed of three amino acids: glutamic acid (Glu), glycine (Gly), and phenylalanine (Phe). This tripeptide exhibits characteristics typical of peptides, including the ability to form hydrogen bonds and participate in various biochemical interactions. It is soluble in water due to the presence of polar amino acids, particularly glutamic acid, which contains a carboxylic acid group. The sequence of amino acids in glu-gly-phe can influence its biological activity, potentially affecting processes such as neurotransmission or metabolic regulation. Additionally, the presence of phenylalanine may contribute to its role in protein synthesis and function. Peptides like glu-gly-phe are often studied for their potential therapeutic applications, including their roles in signaling pathways and as precursors for larger proteins. Overall, glu-gly-phe is a small but significant molecule in biochemistry, reflecting the complexity of protein structure and function.
Formula:C16H21N3O6
InChI:InChI=1/C16H21N3O6/c17-11(6-7-14(21)22)15(23)18-9-13(20)19-12(16(24)25)8-10-4-2-1-3-5-10/h1-5,11-12H,6-9,17H2,(H,18,23)(H,19,20)(H,21,22)(H,24,25)
SMILES:c1ccc(cc1)CC(C(=O)O)N=C(CN=C(C(CCC(=O)O)N)O)O
Synonyms:- H-Glu-Gly-Phe-OH
- Alpha-Glutamylglycylphenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Glu-Gly-Phe-OH
CAS:<p>H-Glu-Gly-Phe-OH is a labile tripeptide molecule that has been synthesized. The tripeptide is synthesized by coupling the amino acid H-Glu to Gly-Phe and then adding an amide bond to form the peptide. This study of the structure of H-Glu-Gly-Phe-OH was done using techniques such as electrospray ionization, chromatographic methods, and proton nuclear magnetic resonance spectroscopy. The compound was found to be neutral in charge and stable at room temperature, but unstable under acidic conditions. It is also soluble in any buffer with a pH range from 2.0 to 12.0 and can be purified by column chromatography or preparative HPLC.</p>Formula:C16H21N3O6Purity:Min. 95%Molecular weight:351.35 g/mol

