CAS 421595-81-5

Imidazo[1,2-a]pyridin-7-ylamine

Description:

Imidazo[1,2-a]pyridin-7-ylamine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a basic nitrogen atom in the pyridine ring, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure allows for the formation of hydrogen bonds, enhancing its solubility in polar solvents. Imidazo[1,2-a]pyridin-7-ylamine is often studied for its biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals targeting various diseases. The compound's reactivity can be influenced by substituents on the rings, which can modulate its electronic properties and biological interactions. Additionally, its relatively low molecular weight and specific functional groups make it a versatile intermediate in organic synthesis. Overall, Imidazo[1,2-a]pyridin-7-ylamine is of significant interest in both academic research and industrial applications due to its diverse chemical behavior and potential therapeutic uses.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c8-6-1-3-10-4-2-9-7(10)5-6/h1-5H,8H2

SMILES: c1cn2ccnc2cc1N

Synonyms:

• Imidazo[1,2-a]pyridin-7-amine
• H-imidazo[1,2-a]pyridin-7-amine

Imidazo[1,2-a]pyridin-7-amine (9CI)

CAS: 421595-81-5

Formula: C₇H₇N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 133.1506

Ref: IN-DA00C7KR

7-Aminoimidazo[1,2-a]pyridine

CAS: 421595-81-5

7-Aminoimidazo[1,2-a]pyridine

Formula: C₇H₇N₃

Purity: 98%

Color and Shape: brown solid

Molecular weight: 133.15g/mol

Ref: 54-OR55000

Imidazo[1,2-a]pyridin-7-amine

CAS: 421595-81-5

Formula: C₇H₇N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 133.154

Ref: 10-F224264