CAS 421595-81-5: Imidazo[1,2-a]pyridin-7-ylamine
Description:Imidazo[1,2-a]pyridin-7-ylamine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a basic nitrogen atom in the pyridine ring, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure allows for the formation of hydrogen bonds, enhancing its solubility in polar solvents. Imidazo[1,2-a]pyridin-7-ylamine is often studied for its biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals targeting various diseases. The compound's reactivity can be influenced by substituents on the rings, which can modulate its electronic properties and biological interactions. Additionally, its relatively low molecular weight and specific functional groups make it a versatile intermediate in organic synthesis. Overall, Imidazo[1,2-a]pyridin-7-ylamine is of significant interest in both academic research and industrial applications due to its diverse chemical behavior and potential therapeutic uses.
Formula:C7H7N3
InChI:InChI=1/C7H7N3/c8-6-1-3-10-4-2-9-7(10)5-6/h1-5H,8H2
- Synonyms:
- Imidazo[1,2-a]pyridin-7-amine
- H-imidazo[1,2-a]pyridin-7-amine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Imidazo[1,2-a]pyridin-7-amine (9CI) REF: IN-DA00C7KRCAS: 421595-81-5 | 98% | To inquire | Tue 08 Apr 25 |
![]() | Imidazo[1,2-a]pyridin-7-amine REF: 10-F224264CAS: 421595-81-5 | 95.0% | 64.00 €~2,783.00 € | Fri 11 Apr 25 |
![]() | 7-Aminoimidazo[1,2-a]pyridine REF: 54-OR55000CAS: 421595-81-5 | 98% | 56.00 €~3,560.00 € | Tue 15 Apr 25 |
![]() | Imidazo[1,2-a]pyridin-7-amine REF: FT-I10767CAS: 421595-81-5 | 95% | - - - | Discontinued product |
![]() | Imidazo[1,2-a]pyridin-7-amine REF: 3D-FI75990CAS: 421595-81-5 | Min. 95% | - - - | Discontinued product |

Imidazo[1,2-a]pyridin-7-amine (9CI)
Ref: IN-DA00C7KR
1g | 164.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 61.00 € | ||
250mg | 73.00 € |

Imidazo[1,2-a]pyridin-7-amine
Ref: 10-F224264
1g | 252.00 € | ||
5g | 856.00 € | ||
25g | 2,783.00 € | ||
100mg | 64.00 € | ||
250mg | 75.00 € |

7-Aminoimidazo[1,2-a]pyridine
Ref: 54-OR55000
1g | 234.00 € | ||
250mg | 96.00 € |

Ref: FT-I10767
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

Imidazo[1,2-a]pyridin-7-amine
Ref: 3D-FI75990
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |