CAS 42173-90-0
:26-(4-Octylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol
Description:
26-(4-Octylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol, with CAS number 42173-90-0, is a synthetic compound characterized by its long-chain structure and the presence of multiple ether linkages. This molecule features a hydrophilic head group (the octaoxahexacosan-1-ol part) and a hydrophobic tail (the 4-octylphenoxy group), which contributes to its amphiphilic nature. Such properties make it suitable for applications in surfactants, emulsifiers, and potentially in drug delivery systems. The presence of the octylphenoxy group enhances its solubility in organic solvents while the polyether chain increases its compatibility with water. The compound is likely to exhibit low toxicity and good biodegradability, making it an attractive candidate for environmentally friendly applications. Its unique structure allows for interactions with various biological membranes, which can be beneficial in pharmaceutical formulations. Overall, this compound's characteristics position it as a versatile agent in both industrial and research settings.
Formula:C32H58O10
InChI:InChI=1S/C32H58O10/c1-2-3-4-5-6-7-8-31-9-11-32(12-10-31)42-30-29-41-28-27-40-26-25-39-24-23-38-22-21-37-20-19-36-18-17-35-16-15-34-14-13-33/h9-12,33H,2-8,13-30H2,1H3
InChI key:InChIKey=LFDLTLMEBDARLN-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCOCCOCCOCCO)C1=CC=C(CCCCCCCC)C=C1
Synonyms:- 3,6,9,12,15,18,21,24-Octaoxahexacosan-1-ol, 26-(p-octylphenoxy)-
- 26-(4-Octylphenoxy)-3,6,9,12,15,18,21,24-octaoxahexacosan-1-ol
- Nona(oxyethylene) glycol mono(4-octylphenyl) ether
- 3,6,9,12,15,18,21,24-Octaoxahexacosan-1-ol, 26-(4-octylphenoxy)-
- Nonaethylene glycol mono(p-octylphenyl) ether
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
