CAS 42185-55-7

5-Hexen-1-one, 1-cyclopropyl-

Description:

5-Hexen-1-one, 1-cyclopropyl- is an organic compound characterized by its structure, which includes a hexene chain and a cyclopropyl group. This compound features a carbonyl functional group (ketone) at the first position of the hexene chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the cyclopropyl group introduces unique steric and electronic properties, which can influence the compound's behavior in chemical reactions. Typically, compounds like 5-Hexen-1-one, 1-cyclopropyl- may exhibit characteristics such as volatility, potential for isomerization, and reactivity towards nucleophiles due to the carbonyl group. Additionally, it may be used in various applications, including as an intermediate in the synthesis of more complex organic molecules or in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₄O

InChI: InChI=1S/C9H14O/c1-2-3-4-5-9(10)8-6-7-8/h2,8H,1,3-7H2

InChI key: InChIKey=IZJNQWOUNRQMKR-UHFFFAOYSA-N

SMILES: C(CCCC=C)(=O)C1CC1

Synonyms:

• 1-Cyclopropylhex-5-en-1-one
• 5-Hexen-1-one, 1-cyclopropyl-

1-Cyclopropylhex-5-en-1-one

CAS: 42185-55-7

Versatile small molecule scaffold

Formula: C₉H₁₄O

Purity: Min. 95%

Molecular weight: 138.2 g/mol

Ref: 3D-SBA18555