CAS 42187-43-9
:2-(dimethoxymethyl)tetrahydrofuran
Description:
2-(Dimethoxymethyl)tetrahydrofuran is an organic compound characterized by its tetrahydrofuran ring, which is a five-membered cyclic ether. This compound features two methoxy groups attached to a methylene bridge, contributing to its unique chemical properties. It is typically a colorless liquid with a pleasant odor, and it is soluble in organic solvents due to its ether functionality. The presence of the dimethoxymethyl group enhances its reactivity, making it useful in various chemical syntheses, particularly in the formation of more complex organic molecules. The compound may exhibit moderate volatility and can participate in nucleophilic substitution reactions due to the presence of the ether oxygen. Additionally, it may have applications in the pharmaceutical and chemical industries, particularly as a solvent or reagent. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(dimethoxymethyl)tetrahydrofuran is a versatile compound with potential utility in organic synthesis.
Formula:C7H14O3
InChI:InChI=1/C7H14O3/c1-8-7(9-2)6-4-3-5-10-6/h6-7H,3-5H2,1-2H3
SMILES:COC(C1CCCO1)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(Dimethoxymethyl)oxolane
CAS:<p>2-(Dimethoxymethyl)oxolane is a polyol that is used as a surface active agent in the manufacture of styrene. It has been shown to have viscosity-increasing properties, which are desirable for use as an emulsifier or dispersant in cyclic, aliphatic hydrocarbon solvents. 2-(Dimethoxymethyl)oxolane can be polymerized and gaseous, with a boiling point of approximately 67 °C (152 °F). It has an expansion coefficient of 1.5 × 10−2 at 25 °C (77 °F), and a surface tension of about 44 mN/m at 25 °C (77 °F).</p>Formula:C7H14O3Purity:Min. 95%Molecular weight:146.18 g/mol
