CAS 42187-43-9: 2-(dimethoxymethyl)tetrahydrofuran

Description: 2-(Dimethoxymethyl)tetrahydrofuran is an organic compound characterized by its tetrahydrofuran ring, which is a five-membered cyclic ether. This compound features two methoxy groups attached to a methylene bridge, contributing to its unique chemical properties. It is typically a colorless liquid with a pleasant odor, and it is soluble in organic solvents due to its ether functionality. The presence of the dimethoxymethyl group enhances its reactivity, making it useful in various chemical syntheses, particularly in the formation of more complex organic molecules. The compound may exhibit moderate volatility and can participate in nucleophilic substitution reactions due to the presence of the ether oxygen. Additionally, it may have applications in the pharmaceutical and chemical industries, particularly as a solvent or reagent. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(dimethoxymethyl)tetrahydrofuran is a versatile compound with potential utility in organic synthesis.

Formula: C₇H₁₄O₃

InChI: InChI=1/C7H14O3/c1-8-7(9-2)6-4-3-5-10-6/h6-7H,3-5H2,1-2H3

2-(Dimethoxymethyl)oxolane

CAS: 42187-43-9

Versatile small molecule scaffold

• Formula: C₇H₁₄O₃
• Purity: Min. 95%
• Molecular weight: 146.18 g/mol

2-(Dimethoxymethyl)oxolane

CAS: 42187-43-9

• Purity: 95%
• Molecular weight: 146.18600463867188