CAS 4219-55-0
:4-propanoylbenzoic acid
Description:
4-Propanoylbenzoic acid, also known as 4-benzoylpropanoic acid, is an aromatic carboxylic acid characterized by the presence of both a benzoic acid moiety and a propanoyl group. Its molecular structure features a benzene ring substituted at the para position with a propanoyl group and a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. The presence of both the carbonyl and carboxylic acid functional groups contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and acylation. 4-Propanoylbenzoic acid may also exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its melting point and boiling point can vary based on purity and environmental conditions. As with many organic compounds, proper handling and safety precautions are essential due to potential irritant properties.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3,(H,12,13)
SMILES:CCC(=O)c1ccc(cc1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Propionylbenzoic acid
CAS:<p>4-Propionylbenzoic acid (4PB) is a racemic mixture of the two enantiomers, 4-propionyloxybenzoic acid and 4-hydroxybenzoic acid. It is an ester formed from terephthalic or isophthalic acids and a propionic acid. The ester group in 4PB reacts with alcohols to form esters, diesters, and condensation products. This compound acts as a muscle relaxant by blocking the action of calcium ions in nerve cells. Its active form can be formed by enzymatic oxidation from its inactive form, 4-hydroxybenzoic acid.</p>Formula:C10H10O3Purity:Min. 95%Molecular weight:178.18 g/mol
