CAS 42198-12-9
:2-methyl-N1-(o-tolyl)propane-1,2-diamine
Description:
2-Methyl-N1-(o-tolyl)propane-1,2-diamine, with the CAS number 42198-12-9, is an organic compound characterized by its amine functional groups. This substance features a branched alkyl chain, specifically a propyl backbone, with two amine groups (-NH2) attached to the first and second carbon atoms. The presence of a methyl group and an o-tolyl group (a toluene derivative with a methyl group in the ortho position) contributes to its steric and electronic properties, influencing its reactivity and solubility. Typically, compounds of this nature exhibit moderate to high polarity due to the amine groups, which can engage in hydrogen bonding. This can affect their boiling and melting points, as well as their solubility in various solvents. Additionally, the presence of aromatic rings may impart stability and influence the compound's interaction with biological systems, making it of interest in pharmaceutical and chemical research. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C11H18N2
InChI:InChI=1/C11H18N2/c1-9-6-4-5-7-10(9)13-8-11(2,3)12/h4-7,13H,8,12H2,1-3H3
SMILES:Cc1ccccc1NCC(C)(C)N
Synonyms:- 1,2-propanediamine, 2-methyl-N< sup> 1< /sup> -(2-methylphenyl)-
- 2-Methyl-N< sup> 1< /sup> -(2-methylphenyl)propan-1,2-diamin
- 2-methyl-N< sup> 1< /sup> -(2-methylphenyl)propane-1,2-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.