CAS 422-30-0
:1,2,2,3,3-pentachloro-1,1-difluoropropane
Description:
1,2,2,3,3-Pentachloro-1,1-difluoropropane, with the CAS number 422-30-0, is a chlorinated and fluorinated organic compound. It is characterized by its high degree of halogenation, which contributes to its chemical stability and potential environmental persistence. This compound typically appears as a colorless liquid and has a relatively high density compared to many organic solvents. Its molecular structure includes five chlorine atoms and two fluorine atoms attached to a three-carbon propane backbone, which influences its reactivity and physical properties. 1,2,2,3,3-Pentachloro-1,1-difluoropropane is known for its applications in various industrial processes, particularly as a solvent and in the formulation of certain chemical products. However, due to its halogenated nature, it may pose environmental and health risks, including potential toxicity and bioaccumulation. Proper handling and disposal measures are essential to mitigate any adverse effects associated with its use.
Formula:C3HCl5F2
InChI:InChI=1/C3HCl5F2/c4-1(5)2(6,7)3(8,9)10/h1H
SMILES:C(C(C(Cl)(F)F)(Cl)Cl)(Cl)Cl
Synonyms:- 1,1-Difluoro-1,2,2,3,3-pentachloro propane
- Propane, 1,2,2,3,3-pentachloro-1,1-difluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2,2,3,3-Pentachloro-1,1-Difluoro-Propane
CAS:Controlled Product1,2,2,3,3-Pentachloro-1,1-difluoro-propane is a solvent that can be used to clean metal parts and surfaces. It is an organic solvent with a strong affinity for water. It has been shown to be effective in the removal of chlorine compounds from natural gas. This solvent is also used as a hydrogen fluoride absorber in the production of magnesium metal. 1,2,2,3,3-Pentachloro-1,1-difluoro-propane has been shown to be energy efficient and low energy in comparison to other solvents. It is not corrosive or flammable and does not produce hazardous byproducts.Formula:C3HCl5F2Purity:Min. 95%Molecular weight:252.3 g/mol
