CAS 4220-05-7
:trifluoro-L-methionine
Description:
Trifluoro-L-methionine is an amino acid derivative characterized by the presence of three fluorine atoms attached to the methionine structure. This modification enhances its biochemical properties, making it a valuable compound in various research applications, particularly in the fields of biochemistry and molecular biology. The trifluoromethyl group can influence the compound's hydrophobicity, stability, and reactivity, which may affect protein folding and interactions. Trifluoro-L-methionine is often used as a building block in peptide synthesis and can serve as a useful tool in studying protein structure and function. Its unique properties allow researchers to explore the effects of fluorinated amino acids on biological systems, potentially leading to insights into drug design and development. Additionally, the compound's stability under various conditions makes it suitable for use in diverse experimental setups. However, due to the presence of fluorine, it is essential to handle trifluoro-L-methionine with care, considering the potential environmental and health impacts associated with fluorinated compounds.
Formula:C5H8F3NO2S
InChI:InChI=1/C5H8F3NO2S/c6-5(7,8)12-2-1-3(9)4(10)11/h3H,1-2,9H2,(H,10,11)/t3-/m0/s1
SMILES:C(CSC(F)(F)F)[C@@H](C(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.