CAS 4220-66-0
:methyl 4,4-dimethoxybutanoate
Description:
Methyl 4,4-dimethoxybutanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a butanoate backbone with two methoxy groups attached to the fourth carbon, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a pleasant, fruity odor, making it potentially useful in flavor and fragrance applications. The presence of the methoxy groups enhances its solubility in organic solvents while affecting its reactivity and stability. Methyl 4,4-dimethoxybutanoate is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular structure allows for potential applications in the development of new materials and compounds. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment to avoid inhalation or skin contact.
Formula:C7H14O4
InChI:InChI=1/C7H14O4/c1-9-6(8)4-5-7(10-2)11-3/h7H,4-5H2,1-3H3
SMILES:COC(=O)CCC(OC)OC
Synonyms:- Butanoic Acid, 4,4-Dimethoxy-, Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,4-Dimethoxybutanoic acid methyl ester
CAS:Formula:C7H14O4Purity:97%Color and Shape:LiquidMolecular weight:162.1837Methyl 4,4-dimethoxybutanoate
CAS:Methyl 4,4-dimethoxybutanoatePurity:97%Molecular weight:162.19g/mol4,4-Dimethoxybutanoic Acid Methyl Ester
CAS:<p>4,4-Dimethoxybutanoic Acid Methyl Ester is a synthetic compound that can be synthesized by ring-opening of the iminium salt. The stereoselective synthesis of this compound has been achieved through the use of a chiral auxiliary. This compound has shown biological properties in some studies, such as inhibition of glutamic and threonine amide synthesis. 4,4-Dimethoxybutanoic Acid Methyl Ester also has the potential to be used in natural product synthesis.</p>Formula:C7H14O4Purity:Min. 95%Molecular weight:162.18 g/mol



