CAS 42201-71-8
:Methyl (trimethylsilyl)propiolate
Description:
Methyl (trimethylsilyl)propiolate, with the CAS number 42201-71-8, is an organic compound characterized by its unique structure that includes a propiolate functional group and a trimethylsilyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its volatility and low viscosity. It has a relatively low boiling point, which makes it useful in various chemical reactions, particularly in organic synthesis. Methyl (trimethylsilyl)propiolate is often employed as a reagent in the formation of carbon-carbon bonds and in the synthesis of more complex molecules. Its trimethylsilyl group enhances its stability and solubility in organic solvents, making it a valuable intermediate in synthetic chemistry. Additionally, it may exhibit reactivity towards nucleophiles due to the electrophilic nature of the carbonyl carbon in the propiolate moiety. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C7H12O2Si
InChI:InChI=1/C7H12O2Si/c1-9-7(8)5-6-10(2,3)4/h1-4H3
SMILES:COC(=O)C#C[Si](C)(C)C
Synonyms:- Methyl 3-trimethylsilylpropynoate
- Methyl 3-(Trimethylsilyl)Prop-2-Ynoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl (trimethylsilyl)propiolate, 98%
CAS:<p>Methyl (trimethylsilyl)propiolate is used as the intermediates of OLED, pharmaceuticals. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / i</p>Formula:C7H12O2SiPurity:98%Color and Shape:Clear colorless, LiquidMolecular weight:156.26Methyl 3-(trimethylsilyl)propiolate
CAS:Formula:C7H12O2SiPurity:96%Color and Shape:LiquidMolecular weight:156.2545Methyl 3-(trimethylsilyl)propiolate
CAS:Methyl 3-(trimethylsilyl)propiolatePurity:98%Molecular weight:156.25g/mol
