CAS 42202-95-9
:4-fluoro-N-hydroxybenzenecarboximidoyl chloride
Description:
4-Fluoro-N-hydroxybenzenecarboximidoyl chloride is a chemical compound characterized by its functional groups, including a carboximidoyl chloride and a hydroxy group attached to a benzene ring that also contains a fluorine substituent. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity, particularly due to the presence of the acyl chloride group, which can readily participate in nucleophilic substitution reactions. The fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological systems. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to serve as an intermediate in the formation of more complex molecules. Safety precautions should be taken when handling this substance, as it may be corrosive and harmful upon exposure. Proper storage and handling protocols are essential to ensure safety and stability.
Formula:C7H5ClFNO
InChI:InChI=1/C7H5ClFNO/c8-7(10-11)5-1-3-6(9)4-2-5/h1-4,11H
SMILES:c1cc(ccc1C(=NO)Cl)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
α-chloro-4-fluorobenzaldoxime
CAS:Formula:C7H5ClFNOPurity:95%Color and Shape:SolidMolecular weight:173.5721α-Chloro-4-fluorobenzaldoxime
CAS:α-Chloro-4-fluorobenzaldoximeFormula:C7H5ClFNOPurity:96%Color and Shape: white solidMolecular weight:173.57g/molα-Chloro-4-fluorobenzaldehyde oxime
CAS:Alpha-Chloro-4-fluorobenzaldehyde oxime is a selenium compound that can be stabilized with heat resistance and structuring. It is used as an additive in the plating of alloys, thermoplastics, and rubber products. Alpha-Chloro-4-fluorobenzaldehyde oxime has been shown to have anti-oxidant effects, which may be due to its ability to stabilize free radicals.Formula:C7H5ClFNOPurity:Min. 95%Molecular weight:173.57 g/mola-Chloro-4-fluorobenzaldoxime
CAS:Formula:C7H5ClFNOPurity:95%Color and Shape:SolidMolecular weight:173.57




