CAS 42219-60-3
:(6S,7S,8R,10R,13S,14S,17R)-6-hydroxy-10,13-dimethyl-7-(methylsulfanyl)-1,6,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione
Description:
The chemical substance with the name "(6S,7S,8R,10R,13S,14S,17R)-6-hydroxy-10,13-dimethyl-7-(methylsulfanyl)-1,6,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione" and CAS number "42219-60-3" is a complex organic compound characterized by its multi-ring structure, which includes a spirocyclic framework. This compound features multiple stereocenters, indicating that it exists in specific three-dimensional configurations that can influence its biological activity and chemical reactivity. The presence of functional groups such as hydroxyl (-OH) and methylthio (-S-CH3) groups suggests potential for hydrogen bonding and interactions with other molecules. Its dodecahydro structure indicates a saturated nature, which may contribute to its stability. The compound's unique arrangement of rings and substituents may impart specific properties, making it of interest in fields such as medicinal chemistry or materials science. Overall, its intricate structure and functional groups suggest a diverse range of potential applications and biological interactions.
Formula:C23H32O4S
InChI:InChI=1/C23H32O4S/c1-21-8-4-13(24)12-16(21)19(26)20(28-3)18-14(21)5-9-22(2)15(18)6-10-23(22)11-7-17(25)27-23/h12,14-15,18-20,26H,4-11H2,1-3H3/t14?,15-,18+,19-,20-,21+,22-,23+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6b-Hydroxy-7a-(thiomethyl) spironolactone
CAS:6b-Hydroxy-7a-(thiomethyl) spironolactone is a drug that is metabolized in the liver and excreted in the bile. It has been found to be safe and effective for the treatment of ascites due to cirrhosis. The pharmacokinetics of 6b-hydroxy-7a-(thiomethyl) spironolactone are linear, with a plasma elimination rate of 0.3 mg/kg/h. The elimination half-life for 6b-hydroxy-7a-(thiomethyl) spironolactone is about 3 hours. 6b-Hydroxy-7a-(thiomethyl) spironolactone has been found to be eliminated from the body at a constant rate, regardless of age, gender or weight. The population studied was healthy adult males who ingested 6b-hydroxy-7a-(thiomethFormula:C23H32O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:404.56 g/mol


