CAS 42219-60-3: (6S,7S,8R,10R,13S,14S,17R)-6-hydroxy-10,13-dimethyl-7-(methylsulfanyl)-1,6,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione
Description:The chemical substance with the name "(6S,7S,8R,10R,13S,14S,17R)-6-hydroxy-10,13-dimethyl-7-(methylsulfanyl)-1,6,7,8,9,10,11,12,13,14,15,16-dodecahydro-3'H-spiro[cyclopenta[a]phenanthrene-17,2'-furan]-3,5'(2H,4'H)-dione" and CAS number "42219-60-3" is a complex organic compound characterized by its multi-ring structure, which includes a spirocyclic framework. This compound features multiple stereocenters, indicating that it exists in specific three-dimensional configurations that can influence its biological activity and chemical reactivity. The presence of functional groups such as hydroxyl (-OH) and methylthio (-S-CH3) groups suggests potential for hydrogen bonding and interactions with other molecules. Its dodecahydro structure indicates a saturated nature, which may contribute to its stability. The compound's unique arrangement of rings and substituents may impart specific properties, making it of interest in fields such as medicinal chemistry or materials science. Overall, its intricate structure and functional groups suggest a diverse range of potential applications and biological interactions.
Formula:C23H32O4S
InChI:InChI=1/C23H32O4S/c1-21-8-4-13(24)12-16(21)19(26)20(28-3)18-14(21)5-9-22(2)15(18)6-10-23(22)11-7-17(25)27-23/h12,14-15,18-20,26H,4-11H2,1-3H3/t14?,15-,18+,19-,20-,21+,22-,23+/m0/s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Spironolactone Impurity 17 REF: 4Z-S-0834CAS: 42219-60-3 | - - - | To inquire | Mon 21 Apr 25 |
![]() | 6b-Hydroxy-7a-(thiomethyl) spironolactone REF: 3D-FH24296CAS: 42219-60-3 | Min. 95% | 465.00 €~3,068.00 € | Wed 23 Apr 25 |

Ref: 4Z-S-0834
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

6b-Hydroxy-7a-(thiomethyl) spironolactone
Ref: 3D-FH24296
1mg | 465.00 € | ||
2mg | 644.00 € | ||
5mg | 1,130.00 € | ||
10mg | 1,780.00 € | ||
25mg | 3,068.00 € |