CAS 42220-77-9
:(2E)-1-(2-hydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one
Description:
The chemical substance known as (2E)-1-(2-hydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one, with the CAS number 42220-77-9, is a type of chalcone, which is characterized by its structure featuring a conjugated system of carbonyl and alkene groups. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of hydroxyl and methoxy substituents on the phenyl rings enhances its reactivity and solubility in organic solvents. Chalcones like this one are often studied for their ability to interact with various biological targets, making them of interest in medicinal chemistry. Additionally, they may exhibit fluorescence properties, which can be useful in various applications, including imaging and sensing. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-19-16-9-5-2-6-12(16)10-11-15(18)13-7-3-4-8-14(13)17/h2-11,17H,1H3/b11-10+
Synonyms:- 2'-Hydroxy-2-methoxychalcone
- 42220-77-9
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2'-Hydroxy-2-methoxychalcone
CAS:Formula:C16H14O3Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:254.292'-Hydroxy-2-methoxychalcone
CAS:Formula:C16H14O3Purity:98%Color and Shape:SolidMolecular weight:254.28062'-Hydroxy-2-methoxychalcone
CAS:2'-Hydroxy-2-methoxychalconePurity:≥98%Molecular weight:254.28g/mol1-(2-Hydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one
CAS:1-(2-Hydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-onePurity:98%Molecular weight:254.28g/mol2'-Hydroxy-2-methoxychalcone
CAS:2'-Hydroxy-2-methoxychalcone is a synthetic chalcone with antibacterial activity.Formula:C16H14O3Purity:99.36%Color and Shape:SolidMolecular weight:254.28Ref: TM-T7432
2mg35.00€5mg50.00€10mg74.00€25mg137.00€50mg197.00€100mg286.00€200mg396.00€1mL*10mM (DMSO)51.00€2'-Hydroxy-2-methoxychalcone
CAS:<p>2'-Hydroxy-2-methoxychalcone is a bioactive compound, specifically classified as a type of chalcone. Chalcones are aromatic ketones, and this particular variant is often derived from natural sources such as plants. The synthesis of 2'-Hydroxy-2-methoxychalcone can also be achieved through chemical methods that mimic natural pathways, providing a consistent and pure product for research purposes.</p>Formula:C16H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:254.28 g/mol




