CAS 4224-63-9

6-Iodohexanoic acid

Description:

6-Iodohexanoic acid is a carboxylic acid characterized by the presence of an iodine atom at the sixth carbon of a hexanoic acid chain. Its molecular formula is C6H11I O2, indicating it contains six carbon atoms, eleven hydrogen atoms, one iodine atom, and two oxygen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. The presence of the iodine atom can impart unique reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 6-iodohexanoic acid can participate in nucleophilic substitution reactions, allowing for further functionalization. Safety considerations should be taken into account when handling this compound, as iodine can be hazardous, and appropriate protective measures should be employed. Overall, 6-iodohexanoic acid is a versatile intermediate in organic synthesis with potential applications in multiple fields.

Formula: C₆H₁₁IO₂

InChI: InChI=1S/C6H11IO2/c7-5-3-1-2-4-6(8)9/h1-5H2,(H,8,9)

InChI key: InChIKey=STHOLCAXALUYCX-UHFFFAOYSA-N

SMILES: C(CC(O)=O)CCCI

Synonyms:

• 6-Iodohexanoic acid
• 6-Iodocaproic acid
• Hexaneperoxoic acid, 6-iodo-
• Hexanoic acid, 6-iodo-

6-Iodohexanoic acid

CAS: 4224-63-9

6-Iodohexanoic acid

Purity: ≥95%

Molecular weight: 242.0548g/mol

Ref: 54-OR183411

6-Iodohexanoic acid

CAS: 4224-63-9

6-Iodohexanoic acid is a chemical compound that belongs to the group of 6-hydroxyhexanoic acid fatty acids. It is synthesized by reacting the corresponding nitro compound with an acceptor such as 6-hydroxyhexanoic acid. The synthetic route for 6-iodohexanoic acid includes the use of phenyliodine diacetate and nitric acid. 6-Iodohexanoic acid has been shown to have activity against pests such as lepidoptera, which are insects that include butterflies and moths. 6-Iodohexanoic acid is also known to be an important histone deacetylase inhibitor. This inhibitor suppresses cancer cell growth and proliferation, which may be due to its ability to inhibit the activity of enzymes involved in the synthesis of prostaglandins.

Formula: C₆H₁₁IO₂

Purity: Min. 95%

Molecular weight: 242.05 g/mol

Ref: 3D-EAA22463