CAS 42242-11-5

3-Amino-2-pyridinecarbonitrile

Description:

3-Amino-2-pyridinecarbonitrile, with the CAS number 42242-11-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a cyano group (-C≡N) attached to the pyridine ring, specifically at the 3 and 2 positions, respectively. The presence of these functional groups imparts distinct chemical properties, such as the ability to participate in hydrogen bonding due to the amino group and the potential for nucleophilic reactions due to the electron-withdrawing nature of the cyano group. 3-Amino-2-pyridinecarbonitrile is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. It is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in the synthesis of pharmaceuticals and agrochemicals. As with many nitrogen-containing heterocycles, it may also exhibit biological activity, making it a subject of research in drug development.

Formula: C₆H₅N₃

InChI: InChI=1/C6H5N3/c7-4-6-5(8)2-1-3-9-6/h1-3H,8H2

SMILES: c1cc(c(C#N)nc1)N

Synonyms:

• 3-Amino-2-cyanopyridine
• 3-Aminopyridine-2-Carbonitrile

3-Aminopicolinonitrile

CAS: 42242-11-5

Formula: C₆H₅N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 119.1240

Ref: IN-DA003IUM

3-Aminopyridine-2-carbonitrile

CAS: 42242-11-5

3-Aminopyridine-2-carbonitrile

Purity: 97%

Color and Shape: Solid

Molecular weight: 119.12g/mol

Ref: 54-OR40675

3-Aminopicolinonitrile

CAS: 42242-11-5

Formula: C₆H₅N₃

Purity: 95%

Color and Shape: Solid, Crystalline

Molecular weight: 119.127

Ref: 10-F236647