CAS 42247-74-5

(S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol

Description:

(S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol is a chiral organic compound characterized by its specific stereochemistry, indicated by the (S) configuration. This compound features a phenolic structure with two chlorine atoms and one fluorine atom substituted on the aromatic ring, which contributes to its unique chemical properties and potential biological activity. The presence of the hydroxyl (-OH) group in the ethanol moiety enhances its solubility in polar solvents and may influence its reactivity in various chemical reactions. The dichloro and fluoro substituents can significantly affect the compound's electronic properties, potentially impacting its interactions with biological targets. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could lead to specific interactions with enzymes or receptors. Additionally, the chirality of the molecule may result in different biological activities for its enantiomers, making it essential to consider its stereochemical configuration in research and application. Overall, (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol represents a complex and potentially useful chemical entity in various scientific fields.

Formula: C₈H₇Cl₂FO

InChI: InChI=1/C8H7Cl2FO/c1-4(12)7-5(9)2-3-6(11)8(7)10/h2-4,12H,1H3/t4-/m0/s1

SMILES: C[C@@H](c1c(ccc(c1Cl)F)Cl)O

Synonyms:

• (S)-1-2,6-dichloro-3-fluorophenylethanol
• (1S)-1-(2,6-dichloro-3-fluorophenyl)ethanol
• 2-(2-Hydroxyethyl)Benzonitrile

2-(2-Hydroxyethyl)benzonitrile

CAS: 42247-74-5

Formula: C₉H₉NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 147.1739

Ref: IN-DA00731L

2-(2-Hydroxyethyl)benzonitrile

CAS: 42247-74-5

2-(2-Hydroxyethyl)benzonitrile

Purity: 95%

Molecular weight: 147.17g/mol

Ref: 54-OR79116

2-(2-Hydroxyethyl)benzonitrile

CAS: 42247-74-5

Formula: C₉H₉NO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 147.177

Ref: 10-F043962