CAS 4225-92-7

2-bromo-1-(2,4,6-trimethylphenyl)ethanone

Description:

2-bromo-1-(2,4,6-trimethylphenyl)ethanone, with the CAS number 4225-92-7, is an organic compound characterized by its ketone functional group and the presence of a bromine atom. This compound features a phenyl ring that is heavily substituted with three methyl groups at the 2, 4, and 6 positions, contributing to its steric bulk and hydrophobic nature. The bromine atom introduces a halogen, which can enhance reactivity in nucleophilic substitution reactions. The ketone group indicates that the compound can participate in various chemical reactions, such as oxidation and reduction. Its structure suggests that it may exhibit interesting physical properties, including solubility in organic solvents and potential applications in organic synthesis or as an intermediate in the production of other chemical compounds. Additionally, the presence of the bulky trimethylphenyl group may influence its reactivity and stability, making it a subject of interest in synthetic organic chemistry.

Formula: C₁₁H₁₃BrO

InChI: InChI=1/C11H13BrO/c1-7-4-8(2)11(9(3)5-7)10(13)6-12/h4-5H,6H2,1-3H3

SMILES: Cc1cc(C)c(c(C)c1)C(=O)CBr

Synonyms:

• 2-Bromo-1-mesitylethanone
• Ethanone, 2-Bromo-1-(2,4,6-Trimethylphenyl)-

2-Bromo-1-mesitylethanone

CAS: 4225-92-7

Formula: C₁₁H₁₃BrO

Purity: 96%

Color and Shape: Solid

Molecular weight: 241.1243

Ref: IN-DA00731C

2-Bromo-1-mesitylethanone

CAS: 4225-92-7

2-Bromo-1-mesitylethanone

Purity: 98%

Molecular weight: 241.12g/mol

Ref: 54-OR94094

2-Bromo-1-mesitylethanone

CAS: 4225-92-7

Formula: C₁₁H₁₃BrO

Purity: 96%

Molecular weight: 241.128

Ref: 10-F328978