CAS 422513-13-1: Hesperadin
Description:Hesperadin, with the CAS number 422513-13-1, is a chemical compound that functions primarily as a selective inhibitor of the enzyme Aurora kinase. This enzyme plays a crucial role in cell division and mitosis, making Hesperadin of interest in cancer research and potential therapeutic applications. The compound is characterized by its ability to interfere with the phosphorylation of specific substrates, thereby disrupting the normal cell cycle progression. Hesperadin has been studied for its effects on various cancer cell lines, demonstrating potential in inhibiting tumor growth. Additionally, it is known for its relatively low toxicity in non-cancerous cells, which is a desirable trait for therapeutic agents. The compound is typically used in laboratory settings for research purposes, and its efficacy and safety profiles are subjects of ongoing investigation. As with many chemical substances, proper handling and safety protocols should be observed when working with Hesperadin in a laboratory environment.
Formula:C29H32N4O3S
InChI:InChI=1S/C29H32N4O3S/c1-2-37(35,36)32-24-15-16-26-25(19-24)27(29(34)31-26)28(22-9-5-3-6-10-22)30-23-13-11-21(12-14-23)20-33-17-7-4-8-18-33/h3,5-6,9-16,19,30,32H,2,4,7-8,17-18,20H2,1H3,(H,31,34)/b28-27-
InChI key:InChIKey=GLDSKRNGVVYJAB-DQSJHHFOSA-N
SMILES:O=C1NC2=CC=C(C=C2C1=C(NC3=CC=C(C=C3)CN4CCCCC4)C=5C=CC=CC5)NS(=O)(=O)CC
- Synonyms:
- Ethanesulfonamide, N-[2,3-dihydro-2-oxo-3-[(3Z)-phenyl[[4-(1-piperidinylmethyl)phenyl]amino]methylene]-1H-indol-5-yl]-
- Hesperadin
- N-[2,3-Dihydro-2-oxo-3-[(3Z)-phenyl[[4-(1-piperidinylmethyl)phenyl]amino]methylene]-1H-indol-5-yl]ethanesulfonamide
- Ethanesulfonamide, N-[(3Z)-2,3-dihydro-2-oxo-3-[phenyl[[4-(1-piperidinylmethyl)phenyl]amino]methylene]-1H-indol-5-yl]-
- Hesperadine
![(Z)-N-[2-Oxo-3-[Phenyl[[4-(Piperidin-1-Ylmethyl)Phenyl]Amino]Methylene]Indolin-5-Yl]Ethanesulfonam…](https://static.cymitquimica.com/products/54/thumb/OR1023283.jpg)
