CAS 42282-85-9
:3,3-diethylazetidine-2,4-dione
Description:
3,3-Diethylazetidine-2,4-dione, with the CAS number 42282-85-9, is a cyclic compound characterized by its azetidine ring structure, which contains a nitrogen atom and two carbonyl groups at the 2 and 4 positions. This compound is a derivative of azetidine, a four-membered saturated heterocycle, and features two ethyl groups attached to the nitrogen atom, contributing to its unique properties. The presence of the carbonyl groups indicates that it can participate in various chemical reactions, such as nucleophilic additions and cyclization processes. The compound is likely to exhibit moderate polarity due to the presence of the carbonyl functionalities, which can influence its solubility in organic solvents. Additionally, the steric hindrance introduced by the ethyl groups may affect its reactivity and interactions with other molecules. Overall, 3,3-diethylazetidine-2,4-dione is of interest in organic synthesis and may have potential applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and reactivity.
Formula:C7H11NO2
InChI:InChI=1/C7H11NO2/c1-3-7(4-2)5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10)
SMILES:CCC1(CC)C(=NC1=O)O
Synonyms:- 2,4-Azetidinedione, 3,3-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,3-Diethylazetidine-2,4-dione
CAS:Controlled ProductFormula:C7H11NO2Color and Shape:NeatMolecular weight:141.17
