CAS 42287-94-5

3-(4-Cyanophenyl)propanoic acid

Description:

3-(4-Cyanophenyl)propanoic acid, with the CAS number 42287-94-5, is an organic compound characterized by its propanoic acid backbone substituted with a cyanophenyl group at the 3-position. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the cyano group (-CN) contributes to its polarity and can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its structural features suggest potential applications in materials science and organic synthesis, particularly in the development of dyes, agrochemicals, or intermediates for more complex organic molecules. Overall, 3-(4-Cyanophenyl)propanoic acid is a versatile compound with significant implications in both industrial and research settings.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c11-7-9-3-1-8(2-4-9)5-6-10(12)13/h1-4H,5-6H2,(H,12,13)

SMILES: c1cc(ccc1CCC(=O)O)C#N

Synonyms:

• Benzenepropanoic Acid, 4-Cyano-
• 3-(4-CYANOPHENYL)PROPANOIC ACID

3-(4-Cyanophenyl)propanoic acid

CAS: 42287-94-5

Formula: C₁₀H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA003I47

3-(4-Cyanophenyl)propanoic acid

CAS: 42287-94-5

3-(4-Cyanophenyl)propanoic acid

Purity: 98%

Molecular weight: 175.18g/mol

Ref: 54-OR964275

3-(4-Cyano-phenyl)-propionic acid

CAS: 42287-94-5

Formula: C₁₀H₉NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 175.187

Ref: 10-F049378