
CAS 4229-50-9
:N-Methyl-5′-adenylic acid
Description:
N-Methyl-5′-adenylic acid, also known as N6-methyladenosine monophosphate, is a derivative of adenosine, which is a nucleoside composed of adenine and ribose. This compound features a methyl group attached to the nitrogen atom at the 6-position of the adenine base. It is characterized by its role in various biochemical processes, particularly in RNA metabolism and regulation. N-Methyl-5′-adenylic acid is involved in the modification of RNA molecules, influencing their stability, translation, and overall function. The presence of the methyl group can affect the compound's solubility and interaction with other biomolecules. As a nucleotide derivative, it can participate in phosphorylation reactions and serve as a substrate for various enzymes. Its CAS number, 4229-50-9, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, N-Methyl-5′-adenylic acid is significant in molecular biology and biochemistry, contributing to the understanding of gene expression and regulation.
Formula:C11H16N5O7P
InChI:InChI=1S/C11H16N5O7P/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(18)7(17)5(23-11)2-22-24(19,20)21/h3-5,7-8,11,17-18H,2H2,1H3,(H,12,13,14)(H2,19,20,21)/t5-,7-,8-,11-/m1/s1
InChI key:InChIKey=WETVNPRPZIYMAC-IOSLPCCCSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(NC)N=CN3)O[C@H](COP(=O)(O)O)[C@H]1O
Synonyms:- Adenosine, N-methyl-, 5′-(dihydrogen phosphate)
- Adenine, N6-methyl-9-β-D-ribofuranosyl-, 5′-phosphate
- N-Methyl-5′-adenylic acid
- Adenosine, N-methyl-, 5′-phosphate
- 5′-Adenylic acid, N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N6-Methyladenosine-5'-monophosphate
CAS:Controlled ProductApplications N6-Methyladenosine-5'-monophosphate sodium salt (cas# 81921-35-9) is a useful research chemical.
Formula:C11H16N5O7PColor and Shape:NeatMolecular weight:361.25

